About N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine
N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine (PubChem CID 134466184) has the molecular formula C12H18FN
and a molecular weight of 195.28 g/mol. Its IUPAC name is N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine |
| PubChem CID | 134466184 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine |
| SMILES | CC1=CC=C(NCC/C=C\C(C)F)C1 |
| InChI | InChI=1S/C12H18FN/c1-10-6-7-12(9-10)14-8-4-3-5-11(2)13/h3,5-7,11,14H,4,8-9H2,1-2H3/b5-3- |
| InChIKey | HHGGZURGORVUIJ-HYXAFXHYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine?
The IUPAC name of N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine (CID 134466184) is N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine.
What is the SMILES notation for N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine?
The canonical SMILES for N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine is CC1=CC=C(NCC/C=C\C(C)F)C1.
What is the InChIKey of N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine?
The InChIKey is HHGGZURGORVUIJ-HYXAFXHYSA-N. The full InChI is InChI=1S/C12H18FN/c1-10-6-7-12(9-10)14-8-4-3-5-11(2)13/h3,5-7,11,14H,4,8-9H2,1-2H3/b5-3-.
What are the key properties of N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine?
N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine has a molecular weight of 195.28 g/mol, XLogP of 3.11, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-5-fluorohex-3-enyl]-4-methylcyclopenta-1,3-dien-1-amine is sourced from PubChem (CID 134466184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).