C15H25F2N — CID 134466286
(E,2E)-2-(3,3-difluorobutan-2-ylidene)-N,3,5,5-tetramethylhept-3-en-1-imine (PubChem CID 134466286) has the molecular formula C15H25F2N and a molecular weight of 257.37 g/mol. Its IUPAC name is (E,2E)-2-(3,3-difluorobutan-2-ylidene)-N,3,5,5-tetramethylhept-3-en-1-imine.
| Compound Name | (E,2E)-2-(3,3-difluorobutan-2-ylidene)-N,3,5,5-tetramethylhept-3-en-1-imine |
|---|---|
| PubChem CID | 134466286 |
| Molecular Formula | C15H25F2N |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | (E,2E)-2-(3,3-difluorobutan-2-ylidene)-N,3,5,5-tetramethylhept-3-en-1-imine |
| SMILES | CCC(C)(C)/C=C(C)/C(/C=N/C)=C(/C)C(C)(F)F |
| InChI | InChI=1S/C15H25F2N/c1-8-14(4,5)9-11(2)13(10-18-7)12(3)15(6,16)17/h9-10H,8H2,1-7H3/b11-9+,13-12-,18-10+ |
| InChIKey | APHMFOYLQRSBBR-DTUNRVKRSA-N |
| XLogP | 5.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|