C14H22F3N — CID 134466390
(E,2E)-N,3,5,5-tetramethyl-2-(1,1,1-trifluoropropan-2-ylidene)hept-3-en-1-imine (PubChem CID 134466390) has the molecular formula C14H22F3N and a molecular weight of 261.33 g/mol. Its IUPAC name is (E,2E)-N,3,5,5-tetramethyl-2-(1,1,1-trifluoropropan-2-ylidene)hept-3-en-1-imine.
| Compound Name | (E,2E)-N,3,5,5-tetramethyl-2-(1,1,1-trifluoropropan-2-ylidene)hept-3-en-1-imine |
|---|---|
| PubChem CID | 134466390 |
| Molecular Formula | C14H22F3N |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (E,2E)-N,3,5,5-tetramethyl-2-(1,1,1-trifluoropropan-2-ylidene)hept-3-en-1-imine |
| SMILES | CCC(C)(C)/C=C(C)/C(/C=N/C)=C(/C)C(F)(F)F |
| InChI | InChI=1S/C14H22F3N/c1-7-13(4,5)8-10(2)12(9-18-6)11(3)14(15,16)17/h8-9H,7H2,1-6H3/b10-8+,12-11-,18-9+ |
| InChIKey | YPPUXURDTPTBCN-JWGBFBROSA-N |
| XLogP | 4.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|