About 5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole
5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole (PubChem CID 134466447) has the molecular formula C9H14F2N2
and a molecular weight of 188.22 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole.
Molecular Properties
| Compound Name | 5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole |
| PubChem CID | 134466447 |
| Molecular Formula | C9H14F2N2 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole |
| SMILES | C=CC1=C(C(C)(F)F)N(C)N(C)C1 |
| InChI | InChI=1S/C9H14F2N2/c1-5-7-6-12(3)13(4)8(7)9(2,10)11/h5H,1,6H2,2-4H3 |
| InChIKey | HIFYIXNXPFWVKA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole?
The IUPAC name of 5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole (CID 134466447) is 5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole.
What is the SMILES notation for 5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole?
The canonical SMILES for 5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole is C=CC1=C(C(C)(F)F)N(C)N(C)C1.
What is the InChIKey of 5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole?
The InChIKey is HIFYIXNXPFWVKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2N2/c1-5-7-6-12(3)13(4)8(7)9(2,10)11/h5H,1,6H2,2-4H3.
What are the key properties of 5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole?
5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole has a molecular weight of 188.22 g/mol, XLogP of 1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-difluoroethyl)-4-ethenyl-1,2-dimethyl-3H-pyrazole is sourced from PubChem (CID 134466447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).