About (E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol
(E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol (PubChem CID 134466471) has the molecular formula C13H18F2N2O2
and a molecular weight of 272.29 g/mol. Its IUPAC name is (E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol.
Molecular Properties
| Compound Name | (E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol |
| PubChem CID | 134466471 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol |
| SMILES | CO/C(O)=C1\CCC(n2ncc(C)c2C(C)(F)F)C1 |
| InChI | InChI=1S/C13H18F2N2O2/c1-8-7-16-17(11(8)13(2,14)15)10-5-4-9(6-10)12(18)19-3/h7,10,18H,4-6H2,1-3H3/b12-9+ |
| InChIKey | NSCOMZKTUSBVSB-FMIVXFBMSA-N |
| XLogP | 3.44 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol?
The IUPAC name of (E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol (CID 134466471) is (E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol.
What is the SMILES notation for (E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol?
The canonical SMILES for (E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol is CO/C(O)=C1\CCC(n2ncc(C)c2C(C)(F)F)C1.
What is the InChIKey of (E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol?
The InChIKey is NSCOMZKTUSBVSB-FMIVXFBMSA-N. The full InChI is InChI=1S/C13H18F2N2O2/c1-8-7-16-17(11(8)13(2,14)15)10-5-4-9(6-10)12(18)19-3/h7,10,18H,4-6H2,1-3H3/b12-9+.
What are the key properties of (E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol?
(E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol has a molecular weight of 272.29 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-[3-[5-(1,1-difluoroethyl)-4-methylpyrazol-1-yl]cyclopentylidene]-methoxymethanol is sourced from PubChem (CID 134466471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).