C20H23ClN2O6S — CID 134466635
N-[[(3R,4S,5R)-5-[[(4-chlorophenyl)sulfonylamino]methyl]-4-hydroxy-3-methyloxolan-3-yl]methyl]-N-hydroxybenzamide (PubChem CID 134466635) has the molecular formula C20H23ClN2O6S and a molecular weight of 454.93 g/mol. Its IUPAC name is N-[[(3R,4S,5R)-5-[[(4-chlorophenyl)sulfonylamino]methyl]-4-hydroxy-3-methyloxolan-3-yl]methyl]-N-hydroxybenzamide.
| Compound Name | N-[[(3R,4S,5R)-5-[[(4-chlorophenyl)sulfonylamino]methyl]-4-hydroxy-3-methyloxolan-3-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 134466635 |
| Molecular Formula | C20H23ClN2O6S |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | N-[[(3R,4S,5R)-5-[[(4-chlorophenyl)sulfonylamino]methyl]-4-hydroxy-3-methyloxolan-3-yl]methyl]-N-hydroxybenzamide |
| SMILES | C[C@@]1(CN(O)C(=O)c2ccccc2)CO[C@H](CNS(=O)(=O)c2ccc(Cl)cc2)[C@H]1O |
| InChI | InChI=1S/C20H23ClN2O6S/c1-20(12-23(26)19(25)14-5-3-2-4-6-14)13-29-17(18(20)24)11-22-30(27,28)16-9-7-15(21)8-10-16/h2-10,17-18,22,24,26H,11-13H2,1H3/t17-,18-,20-/m1/s1 |
| InChIKey | RPIFDLASLGPORF-QWFCFKBJSA-N |
| XLogP | 1.92 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|