C19H22F3N5O3S — CID 134466777
N-[(1E,3Z)-2-amino-5,5,5-trifluoro-4-(hydroxyamino)-1-methoxypenta-1,3-dienyl]-5-(1-cyanocyclopropyl)-3-ethylsulfanyl-N-methylpyridine-2-carboxamide (PubChem CID 134466777) has the molecular formula C19H22F3N5O3S and a molecular weight of 457.48 g/mol. Its IUPAC name is N-[(1E,3Z)-2-amino-5,5,5-trifluoro-4-(hydroxyamino)-1-methoxypenta-1,3-dienyl]-5-(1-cyanocyclopropyl)-3-ethylsulfanyl-N-methylpyridine-2-carboxamide.
| Compound Name | N-[(1E,3Z)-2-amino-5,5,5-trifluoro-4-(hydroxyamino)-1-methoxypenta-1,3-dienyl]-5-(1-cyanocyclopropyl)-3-ethylsulfanyl-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 134466777 |
| Molecular Formula | C19H22F3N5O3S |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | N-[(1E,3Z)-2-amino-5,5,5-trifluoro-4-(hydroxyamino)-1-methoxypenta-1,3-dienyl]-5-(1-cyanocyclopropyl)-3-ethylsulfanyl-N-methylpyridine-2-carboxamide |
| SMILES | CCSc1cc(C2(C#N)CC2)cnc1C(=O)N(C)/C(OC)=C(N)/C=C(\NO)C(F)(F)F |
| InChI | InChI=1S/C19H22F3N5O3S/c1-4-31-13-7-11(18(10-23)5-6-18)9-25-15(13)16(28)27(2)17(30-3)12(24)8-14(26-29)19(20,21)22/h7-9,26,29H,4-6,24H2,1-3H3/b14-8-,17-12+ |
| InChIKey | YNLXIGYPNPHQDL-MCPRKVKSSA-N |
| XLogP | 3.02 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|