About 2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole
2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole (PubChem CID 134466894) has the molecular formula C20H18N2O2S
and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole.
Molecular Properties
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole |
| PubChem CID | 134466894 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole |
| SMILES | C=C/C=C(\C=C)c1[nH]c2ccccc2c1C(C[N+](=O)[O-])c1cccs1 |
| InChI | InChI=1S/C20H18N2O2S/c1-3-8-14(4-2)20-19(15-9-5-6-10-17(15)21-20)16(13-22(23)24)18-11-7-12-25-18/h3-12,16,21H,1-2,13H2/b14-8+ |
| InChIKey | LMWCOZVQYOVIGO-RIYZIHGNSA-N |
| XLogP | 5.39 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole?
The IUPAC name of 2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole (CID 134466894) is 2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole.
What is the SMILES notation for 2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole?
The canonical SMILES for 2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole is C=C/C=C(\C=C)c1[nH]c2ccccc2c1C(C[N+](=O)[O-])c1cccs1.
What is the InChIKey of 2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole?
The InChIKey is LMWCOZVQYOVIGO-RIYZIHGNSA-N. The full InChI is InChI=1S/C20H18N2O2S/c1-3-8-14(4-2)20-19(15-9-5-6-10-17(15)21-20)16(13-22(23)24)18-11-7-12-25-18/h3-12,16,21H,1-2,13H2/b14-8+.
What are the key properties of 2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole?
2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole has a molecular weight of 350.44 g/mol, XLogP of 5.39, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3E)-hexa-1,3,5-trien-3-yl]-3-(2-nitro-1-thiophen-2-ylethyl)-1H-indole is sourced from PubChem (CID 134466894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).