C24H28NO4P — CID 134466996
(7-amino-5-ethyl-1-methyl-10-oxo-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl) naphthalene-2-carboxylate (PubChem CID 134466996) has the molecular formula C24H28NO4P and a molecular weight of 425.47 g/mol. Its IUPAC name is (7-amino-5-ethyl-1-methyl-10-oxo-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl) naphthalene-2-carboxylate.
| Compound Name | (7-amino-5-ethyl-1-methyl-10-oxo-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl) naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 134466996 |
| Molecular Formula | C24H28NO4P |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (7-amino-5-ethyl-1-methyl-10-oxo-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-7-yl) naphthalene-2-carboxylate |
| SMILES | CCC1CCC2C1C(N)(OC(=O)c1ccc3ccccc3c1)C1(P)CC(=O)C2(C)O1 |
| InChI | InChI=1S/C24H28NO4P/c1-3-14-10-11-18-20(14)24(25,23(30)13-19(26)22(18,2)29-23)28-21(27)17-9-8-15-6-4-5-7-16(15)12-17/h4-9,12,14,18,20H,3,10-11,13,25,30H2,1-2H3 |
| InChIKey | DIKHTUAOFDOBFG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|