About 5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one
5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one (PubChem CID 134467041) has the molecular formula C13H21O3P
and a molecular weight of 256.28 g/mol. Its IUPAC name is 5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one.
Molecular Properties
| Compound Name | 5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one |
| PubChem CID | 134467041 |
| Molecular Formula | C13H21O3P |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one |
| SMILES | CCC1CCC2C1C(O)C1(P)CC(=O)C2(C)O1 |
| InChI | InChI=1S/C13H21O3P/c1-3-7-4-5-8-10(7)11(15)13(17)6-9(14)12(8,2)16-13/h7-8,10-11,15H,3-6,17H2,1-2H3 |
| InChIKey | ZFCNZADOLNEAMU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one?
The IUPAC name of 5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one (CID 134467041) is 5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one.
What is the SMILES notation for 5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one?
The canonical SMILES for 5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one is CCC1CCC2C1C(O)C1(P)CC(=O)C2(C)O1.
What is the InChIKey of 5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one?
The InChIKey is ZFCNZADOLNEAMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21O3P/c1-3-7-4-5-8-10(7)11(15)13(17)6-9(14)12(8,2)16-13/h7-8,10-11,15H,3-6,17H2,1-2H3.
What are the key properties of 5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one?
5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one has a molecular weight of 256.28 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one is sourced from PubChem (CID 134467041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).