C12H19O3P — CID 134467069
(1S)-7-hydroxy-1,5-dimethyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one (PubChem CID 134467069) has the molecular formula C12H19O3P and a molecular weight of 242.25 g/mol. Its IUPAC name is (1S)-7-hydroxy-1,5-dimethyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one.
| Compound Name | (1S)-7-hydroxy-1,5-dimethyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one |
|---|---|
| PubChem CID | 134467069 |
| Molecular Formula | C12H19O3P |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (1S)-7-hydroxy-1,5-dimethyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one |
| SMILES | CC1CCC2C1C(O)C1(P)CC(=O)[C@@]2(C)O1 |
| InChI | InChI=1S/C12H19O3P/c1-6-3-4-7-9(6)10(14)12(16)5-8(13)11(7,2)15-12/h6-7,9-10,14H,3-5,16H2,1-2H3/t6?,7?,9?,10?,11-,12?/m0/s1 |
| InChIKey | RACCBJCYUCSBNK-YHLUHPMHSA-N |
| XLogP | 1.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|