About 1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane
1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane (PubChem CID 134467176) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is 1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane.
Molecular Properties
| Compound Name | 1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane |
| PubChem CID | 134467176 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane |
| SMILES | C=CCC12CCCC3CC(C)(CCC1)N32 |
| InChI | InChI=1S/C14H23N/c1-3-7-14-9-4-6-12-11-13(2,15(12)14)8-5-10-14/h3,12H,1,4-11H2,2H3 |
| InChIKey | KRNCIDRRFMZAAT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane?
The IUPAC name of 1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane (CID 134467176) is 1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane.
What is the SMILES notation for 1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane?
The canonical SMILES for 1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane is C=CCC12CCCC3CC(C)(CCC1)N32.
What is the InChIKey of 1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane?
The InChIKey is KRNCIDRRFMZAAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N/c1-3-7-14-9-4-6-12-11-13(2,15(12)14)8-5-10-14/h3,12H,1,4-11H2,2H3.
What are the key properties of 1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane?
1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane has a molecular weight of 205.34 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7-prop-2-enyl-11-azatricyclo[5.3.1.03,11]undecane is sourced from PubChem (CID 134467176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).