About 4-ethyl-2,6-dimethyl-3-methylidenepiperidine
4-ethyl-2,6-dimethyl-3-methylidenepiperidine (PubChem CID 134467475) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 4-ethyl-2,6-dimethyl-3-methylidenepiperidine.
Molecular Properties
| Compound Name | 4-ethyl-2,6-dimethyl-3-methylidenepiperidine |
| PubChem CID | 134467475 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 4-ethyl-2,6-dimethyl-3-methylidenepiperidine |
| SMILES | C=C1C(CC)CC(C)NC1C |
| InChI | InChI=1S/C10H19N/c1-5-10-6-7(2)11-9(4)8(10)3/h7,9-11H,3,5-6H2,1-2,4H3 |
| InChIKey | UVUNPMQAGJXKIE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2,6-dimethyl-3-methylidenepiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,6-dimethyl-3-methylidenepiperidine?
The IUPAC name of 4-ethyl-2,6-dimethyl-3-methylidenepiperidine (CID 134467475) is 4-ethyl-2,6-dimethyl-3-methylidenepiperidine.
What is the SMILES notation for 4-ethyl-2,6-dimethyl-3-methylidenepiperidine?
The canonical SMILES for 4-ethyl-2,6-dimethyl-3-methylidenepiperidine is C=C1C(CC)CC(C)NC1C.
What is the InChIKey of 4-ethyl-2,6-dimethyl-3-methylidenepiperidine?
The InChIKey is UVUNPMQAGJXKIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-5-10-6-7(2)11-9(4)8(10)3/h7,9-11H,3,5-6H2,1-2,4H3.
What are the key properties of 4-ethyl-2,6-dimethyl-3-methylidenepiperidine?
4-ethyl-2,6-dimethyl-3-methylidenepiperidine has a molecular weight of 153.27 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,6-dimethyl-3-methylidenepiperidine is sourced from PubChem (CID 134467475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).