C30H46N6O — CID 134467913
6-(1-cyclobutylethylamino)-7-(cyclohexylmethyl)-8-(2-cyclohexylpiperidin-1-yl)purine-2-carbaldehyde (PubChem CID 134467913) has the molecular formula C30H46N6O and a molecular weight of 506.74 g/mol. Its IUPAC name is 6-(1-cyclobutylethylamino)-7-(cyclohexylmethyl)-8-(2-cyclohexylpiperidin-1-yl)purine-2-carbaldehyde.
| Compound Name | 6-(1-cyclobutylethylamino)-7-(cyclohexylmethyl)-8-(2-cyclohexylpiperidin-1-yl)purine-2-carbaldehyde |
|---|---|
| PubChem CID | 134467913 |
| Molecular Formula | C30H46N6O |
| Molecular Weight | 506.74 g/mol |
| Exact Mass | 506.37 |
| IUPAC Name | 6-(1-cyclobutylethylamino)-7-(cyclohexylmethyl)-8-(2-cyclohexylpiperidin-1-yl)purine-2-carbaldehyde |
| SMILES | CC(Nc1nc(C=O)nc2nc(N3CCCCC3C3CCCCC3)n(CC3CCCCC3)c12)C1CCC1 |
| InChI | InChI=1S/C30H46N6O/c1-21(23-15-10-16-23)31-28-27-29(33-26(20-37)32-28)34-30(36(27)19-22-11-4-2-5-12-22)35-18-9-8-17-25(35)24-13-6-3-7-14-24/h20-25H,2-19H2,1H3,(H,31,32,33) |
| InChIKey | JXCBOAXTBYHPKJ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.74 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|