C29H34ClN5 — CID 134467982
7-[(4-chlorophenyl)methyl]-N-(1-cyclobutylbutyl)-8-(3-ethylphenyl)-2-methylpurin-6-amine (PubChem CID 134467982) has the molecular formula C29H34ClN5 and a molecular weight of 488.08 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-N-(1-cyclobutylbutyl)-8-(3-ethylphenyl)-2-methylpurin-6-amine.
| Compound Name | 7-[(4-chlorophenyl)methyl]-N-(1-cyclobutylbutyl)-8-(3-ethylphenyl)-2-methylpurin-6-amine |
|---|---|
| PubChem CID | 134467982 |
| Molecular Formula | C29H34ClN5 |
| Molecular Weight | 488.08 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-N-(1-cyclobutylbutyl)-8-(3-ethylphenyl)-2-methylpurin-6-amine |
| SMILES | CCCC(Nc1nc(C)nc2nc(-c3cccc(CC)c3)n(Cc3ccc(Cl)cc3)c12)C1CCC1 |
| InChI | InChI=1S/C29H34ClN5/c1-4-8-25(22-10-7-11-22)33-27-26-28(32-19(3)31-27)34-29(23-12-6-9-20(5-2)17-23)35(26)18-21-13-15-24(30)16-14-21/h6,9,12-17,22,25H,4-5,7-8,10-11,18H2,1-3H3,(H,31,32,33) |
| InChIKey | ZNJCCLRKVXEKNG-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.08 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |