C16H32Si4 — CID 13446827
1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne (PubChem CID 13446827) has the molecular formula C16H32Si4 and a molecular weight of 336.78 g/mol. Its IUPAC name is 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne.
| Compound Name | 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne |
|---|---|
| PubChem CID | 13446827 |
| Molecular Formula | C16H32Si4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 1,1,4,4,7,7,10,10-octamethyl-1,4,7,10-tetrasilacyclododeca-5,11-diyne |
| SMILES | C[Si]1(C)C#C[Si](C)(C)CC[Si](C)(C)C#C[Si](C)(C)CC1 |
| InChI | InChI=1S/C16H32Si4/c1-17(2)9-11-18(3,4)13-15-20(7,8)16-14-19(5,6)12-10-17/h9,11,14,16H2,1-8H3 |
| InChIKey | AQUSVQUTBLGXHZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|