C19H22O5S — CID 134469343
(3S,3'R,4'S,5'S,6'R)-6'-methyl-5-[(5-methylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 134469343) has the molecular formula C19H22O5S and a molecular weight of 362.45 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6'-methyl-5-[(5-methylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6'-methyl-5-[(5-methylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 134469343 |
| Molecular Formula | C19H22O5S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6'-methyl-5-[(5-methylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | Cc1ccc(Cc2ccc3c(c2)[C@]2(OC3)O[C@H](C)[C@@H](O)[C@H](O)[C@H]2O)s1 |
| InChI | InChI=1S/C19H22O5S/c1-10-3-6-14(25-10)7-12-4-5-13-9-23-19(15(13)8-12)18(22)17(21)16(20)11(2)24-19/h3-6,8,11,16-18,20-22H,7,9H2,1-2H3/t11-,16-,17+,18-,19+/m1/s1 |
| InChIKey | QQEKZPNWONPEHM-ZMKKGPNFSA-N |
| XLogP | 1.83 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |