C20H21ClO7S — CID 134469373
methyl 5-[[(3S,3'R,4'S,5'S,6'R)-6-chloro-3',4',5'-trihydroxy-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-5-yl]methyl]thiophene-2-carboxylate (PubChem CID 134469373) has the molecular formula C20H21ClO7S and a molecular weight of 440.90 g/mol. Its IUPAC name is methyl 5-[[(3S,3'R,4'S,5'S,6'R)-6-chloro-3',4',5'-trihydroxy-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-5-yl]methyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[[(3S,3'R,4'S,5'S,6'R)-6-chloro-3',4',5'-trihydroxy-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-5-yl]methyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 134469373 |
| Molecular Formula | C20H21ClO7S |
| Molecular Weight | 440.90 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | methyl 5-[[(3S,3'R,4'S,5'S,6'R)-6-chloro-3',4',5'-trihydroxy-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-5-yl]methyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(Cc2cc3c(cc2Cl)CO[C@]32O[C@H](C)[C@@H](O)[C@H](O)[C@H]2O)s1 |
| InChI | InChI=1S/C20H21ClO7S/c1-9-16(22)17(23)18(24)20(28-9)13-6-10(14(21)7-11(13)8-27-20)5-12-3-4-15(29-12)19(25)26-2/h3-4,6-7,9,16-18,22-24H,5,8H2,1-2H3/t9-,16-,17+,18-,20+/m1/s1 |
| InChIKey | BDVURBMTGGKNAL-NEPQHZLESA-N |
| XLogP | 1.96 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.90 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |