C23H22FNO4S — CID 134469412
(3S,3'S,4'S,6'R)-6-fluoro-6'-methyl-5-[(5-pyridin-2-ylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4'-diol (PubChem CID 134469412) has the molecular formula C23H22FNO4S and a molecular weight of 427.50 g/mol. Its IUPAC name is (3S,3'S,4'S,6'R)-6-fluoro-6'-methyl-5-[(5-pyridin-2-ylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4'-diol.
| Compound Name | (3S,3'S,4'S,6'R)-6-fluoro-6'-methyl-5-[(5-pyridin-2-ylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4'-diol |
|---|---|
| PubChem CID | 134469412 |
| Molecular Formula | C23H22FNO4S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (3S,3'S,4'S,6'R)-6-fluoro-6'-methyl-5-[(5-pyridin-2-ylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4'-diol |
| SMILES | C[C@@H]1C[C@H](O)[C@H](O)[C@@]2(OCc3cc(F)c(Cc4ccc(-c5ccccn5)s4)cc32)O1 |
| InChI | InChI=1S/C23H22FNO4S/c1-13-8-20(26)22(27)23(29-13)17-10-14(18(24)11-15(17)12-28-23)9-16-5-6-21(30-16)19-4-2-3-7-25-19/h2-7,10-11,13,20,22,26-27H,8-9,12H2,1H3/t13-,20+,22+,23+/m1/s1 |
| InChIKey | OCASHRMMURUZTR-RCQAABFZSA-N |
| XLogP | 3.75 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |