C19H21ClO6S — CID 134469421
(3S,3'R,4'S,5'S,6'R)-6-chloro-5-[[5-(hydroxymethyl)thiophen-2-yl]methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 134469421) has the molecular formula C19H21ClO6S and a molecular weight of 412.89 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[[5-(hydroxymethyl)thiophen-2-yl]methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[[5-(hydroxymethyl)thiophen-2-yl]methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 134469421 |
| Molecular Formula | C19H21ClO6S |
| Molecular Weight | 412.89 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[[5-(hydroxymethyl)thiophen-2-yl]methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | C[C@H]1O[C@]2(OCc3cc(Cl)c(Cc4ccc(CO)s4)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H21ClO6S/c1-9-16(22)17(23)18(24)19(26-9)14-5-10(15(20)6-11(14)8-25-19)4-12-2-3-13(7-21)27-12/h2-3,5-6,9,16-18,21-24H,4,7-8H2,1H3/t9-,16-,17+,18-,19+/m1/s1 |
| InChIKey | DNEHQSOKOHNNGV-UVICMKTJSA-N |
| XLogP | 1.67 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.89 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |