C21H23ClO7S — CID 134469475
methyl 2-[5-[[(3S,3'R,4'S,5'S,6'R)-6-chloro-3',4',5'-trihydroxy-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-5-yl]methyl]thiophen-2-yl]acetate (PubChem CID 134469475) has the molecular formula C21H23ClO7S and a molecular weight of 454.93 g/mol. Its IUPAC name is methyl 2-[5-[[(3S,3'R,4'S,5'S,6'R)-6-chloro-3',4',5'-trihydroxy-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-5-yl]methyl]thiophen-2-yl]acetate.
| Compound Name | methyl 2-[5-[[(3S,3'R,4'S,5'S,6'R)-6-chloro-3',4',5'-trihydroxy-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-5-yl]methyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 134469475 |
| Molecular Formula | C21H23ClO7S |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | methyl 2-[5-[[(3S,3'R,4'S,5'S,6'R)-6-chloro-3',4',5'-trihydroxy-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-5-yl]methyl]thiophen-2-yl]acetate |
| SMILES | COC(=O)Cc1ccc(Cc2cc3c(cc2Cl)CO[C@]32O[C@H](C)[C@@H](O)[C@H](O)[C@H]2O)s1 |
| InChI | InChI=1S/C21H23ClO7S/c1-10-18(24)19(25)20(26)21(29-10)15-6-11(16(22)7-12(15)9-28-21)5-13-3-4-14(30-13)8-17(23)27-2/h3-4,6-7,10,18-20,24-26H,5,8-9H2,1-2H3/t10-,18-,19+,20-,21+/m1/s1 |
| InChIKey | WPODWEIKVASINF-QZDAVUPASA-N |
| XLogP | 1.89 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |