C22H27ClO6S — CID 134469574
(3S,3'R,4'S,5'S,6'R)-6-chloro-5-[[5-(2-ethoxyethyl)thiophen-2-yl]methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 134469574) has the molecular formula C22H27ClO6S and a molecular weight of 454.97 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[[5-(2-ethoxyethyl)thiophen-2-yl]methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[[5-(2-ethoxyethyl)thiophen-2-yl]methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 134469574 |
| Molecular Formula | C22H27ClO6S |
| Molecular Weight | 454.97 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[[5-(2-ethoxyethyl)thiophen-2-yl]methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | CCOCCc1ccc(Cc2cc3c(cc2Cl)CO[C@]32O[C@H](C)[C@@H](O)[C@H](O)[C@H]2O)s1 |
| InChI | InChI=1S/C22H27ClO6S/c1-3-27-7-6-15-4-5-16(30-15)8-13-9-17-14(10-18(13)23)11-28-22(17)21(26)20(25)19(24)12(2)29-22/h4-5,9-10,12,19-21,24-26H,3,6-8,11H2,1-2H3/t12-,19-,20+,21-,22+/m1/s1 |
| InChIKey | DYXHYWYXEQJGCJ-IGLWBYBESA-N |
| XLogP | 2.76 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.97 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|