C24H25NO3S — CID 134469592
(3R,4'S,6'R)-6,6'-dimethyl-5-[(5-phenyl-1,3-thiazol-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-4'-ol (PubChem CID 134469592) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is (3R,4'S,6'R)-6,6'-dimethyl-5-[(5-phenyl-1,3-thiazol-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-4'-ol.
| Compound Name | (3R,4'S,6'R)-6,6'-dimethyl-5-[(5-phenyl-1,3-thiazol-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-4'-ol |
|---|---|
| PubChem CID | 134469592 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (3R,4'S,6'R)-6,6'-dimethyl-5-[(5-phenyl-1,3-thiazol-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-4'-ol |
| SMILES | Cc1cc2c(cc1Cc1ncc(-c3ccccc3)s1)[C@]1(C[C@@H](O)C[C@@H](C)O1)OC2 |
| InChI | InChI=1S/C24H25NO3S/c1-15-8-19-14-27-24(12-20(26)9-16(2)28-24)21(19)10-18(15)11-23-25-13-22(29-23)17-6-4-3-5-7-17/h3-8,10,13,16,20,26H,9,11-12,14H2,1-2H3/t16-,20+,24-/m1/s1 |
| InChIKey | WZPDYUXJRRKMME-AAORUROXSA-N |
| XLogP | 4.95 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |