About 1-(prop-1-en-2-ylamino)ethane-1,2-diol
1-(prop-1-en-2-ylamino)ethane-1,2-diol (PubChem CID 134469667) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is 1-(prop-1-en-2-ylamino)ethane-1,2-diol.
Molecular Properties
| Compound Name | 1-(prop-1-en-2-ylamino)ethane-1,2-diol |
| PubChem CID | 134469667 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | 1-(prop-1-en-2-ylamino)ethane-1,2-diol |
| SMILES | C=C(C)NC(O)CO |
| InChI | InChI=1S/C5H11NO2/c1-4(2)6-5(8)3-7/h5-8H,1,3H2,2H3 |
| InChIKey | GDWCUWIIAHKWGW-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(prop-1-en-2-ylamino)ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(prop-1-en-2-ylamino)ethane-1,2-diol?
The IUPAC name of 1-(prop-1-en-2-ylamino)ethane-1,2-diol (CID 134469667) is 1-(prop-1-en-2-ylamino)ethane-1,2-diol.
What is the SMILES notation for 1-(prop-1-en-2-ylamino)ethane-1,2-diol?
The canonical SMILES for 1-(prop-1-en-2-ylamino)ethane-1,2-diol is C=C(C)NC(O)CO.
What is the InChIKey of 1-(prop-1-en-2-ylamino)ethane-1,2-diol?
The InChIKey is GDWCUWIIAHKWGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2/c1-4(2)6-5(8)3-7/h5-8H,1,3H2,2H3.
What are the key properties of 1-(prop-1-en-2-ylamino)ethane-1,2-diol?
1-(prop-1-en-2-ylamino)ethane-1,2-diol has a molecular weight of 117.15 g/mol, XLogP of -0.58, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(prop-1-en-2-ylamino)ethane-1,2-diol is sourced from PubChem (CID 134469667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).