C22H21F6N5O3 — CID 134469942
N-(2,6-difluorophenyl)-4-[3-[ethyl(methyl)amino]-4-methyl-5-oxo-1,2,4-triazol-1-yl]-5-fluoro-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide (PubChem CID 134469942) has the molecular formula C22H21F6N5O3 and a molecular weight of 517.43 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-4-[3-[ethyl(methyl)amino]-4-methyl-5-oxo-1,2,4-triazol-1-yl]-5-fluoro-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide.
| Compound Name | N-(2,6-difluorophenyl)-4-[3-[ethyl(methyl)amino]-4-methyl-5-oxo-1,2,4-triazol-1-yl]-5-fluoro-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 134469942 |
| Molecular Formula | C22H21F6N5O3 |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | N-(2,6-difluorophenyl)-4-[3-[ethyl(methyl)amino]-4-methyl-5-oxo-1,2,4-triazol-1-yl]-5-fluoro-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide |
| SMILES | CCN(C)c1nn(-c2cc(O[C@@H](C)C(F)(F)F)c(C(=O)Nc3c(F)cccc3F)cc2F)c(=O)n1C |
| InChI | InChI=1S/C22H21F6N5O3/c1-5-31(3)20-30-33(21(35)32(20)4)16-10-17(36-11(2)22(26,27)28)12(9-15(16)25)19(34)29-18-13(23)7-6-8-14(18)24/h6-11H,5H2,1-4H3,(H,29,34)/t11-/m0/s1 |
| InChIKey | QDRDPLLGXGVBEP-NSHDSACASA-N |
| XLogP | 4.03 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |