C18H17BrClF2NO2 — CID 134470072
4-bromo-N-(2-chloro-6-fluorophenyl)-5-fluoro-2-[(2S)-pentan-2-yl]oxybenzamide (PubChem CID 134470072) has the molecular formula C18H17BrClF2NO2 and a molecular weight of 432.69 g/mol. Its IUPAC name is 4-bromo-N-(2-chloro-6-fluorophenyl)-5-fluoro-2-[(2S)-pentan-2-yl]oxybenzamide.
| Compound Name | 4-bromo-N-(2-chloro-6-fluorophenyl)-5-fluoro-2-[(2S)-pentan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 134470072 |
| Molecular Formula | C18H17BrClF2NO2 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 4-bromo-N-(2-chloro-6-fluorophenyl)-5-fluoro-2-[(2S)-pentan-2-yl]oxybenzamide |
| SMILES | CCC[C@H](C)Oc1cc(Br)c(F)cc1C(=O)Nc1c(F)cccc1Cl |
| InChI | InChI=1S/C18H17BrClF2NO2/c1-3-5-10(2)25-16-9-12(19)15(22)8-11(16)18(24)23-17-13(20)6-4-7-14(17)21/h4,6-10H,3,5H2,1-2H3,(H,23,24)/t10-/m0/s1 |
| InChIKey | SMBWTSTWRVJCML-JTQLQIEISA-N |
| XLogP | 6.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |