methyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate

C10H17NO2 — CID 134470243

IUPACmethyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate
SMILESC=C=CC(CCN(C)C)C(=O)OC
InChIInChI=1S/C10H17NO2/c1-5-6-9(10(12)13-4)7-8-11(2)3/h6,9H,1,7-8H2,2-4H3
InChIKeyLDQUAMJOJNHNGZ-UHFFFAOYSA-N
MW183.25 g/mol
LogP1.07
Rot. Bonds5

About methyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate

methyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate (PubChem CID 134470243) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is methyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate.

Molecular Properties

Compound Namemethyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate
PubChem CID134470243
Molecular FormulaC10H17NO2
Molecular Weight183.25 g/mol
Exact Mass183.13
IUPAC Namemethyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate
SMILESC=C=CC(CCN(C)C)C(=O)OC
InChIInChI=1S/C10H17NO2/c1-5-6-9(10(12)13-4)7-8-11(2)3/h6,9H,1,7-8H2,2-4H3
InChIKeyLDQUAMJOJNHNGZ-UHFFFAOYSA-N
XLogP1.07
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.25
LogP ≤ 51.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate?
The IUPAC name of methyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate (CID 134470243) is methyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate.
What is the SMILES notation for methyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate?
The canonical SMILES for methyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate is C=C=CC(CCN(C)C)C(=O)OC.
What is the InChIKey of methyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate?
The InChIKey is LDQUAMJOJNHNGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-5-6-9(10(12)13-4)7-8-11(2)3/h6,9H,1,7-8H2,2-4H3.
What are the key properties of methyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate?
methyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate has a molecular weight of 183.25 g/mol, XLogP of 1.07, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(dimethylamino)ethyl]penta-3,4-dienoate is sourced from PubChem (CID 134470243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).