About N,N-dimethyl-2,3,4,5-tetrahydropyridin-6-amine
N,N-dimethyl-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 13447030) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is N,N-dimethyl-2,3,4,5-tetrahydropyridin-6-amine.
Analyze N,N-dimethyl-2,3,4,5-tetrahydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2,3,4,5-tetrahydropyridin-6-amine?
The IUPAC name of N,N-dimethyl-2,3,4,5-tetrahydropyridin-6-amine (CID 13447030) is N,N-dimethyl-2,3,4,5-tetrahydropyridin-6-amine.
What is the SMILES notation for N,N-dimethyl-2,3,4,5-tetrahydropyridin-6-amine?
The canonical SMILES for N,N-dimethyl-2,3,4,5-tetrahydropyridin-6-amine is CN(C)C1=NCCCC1.
What is the InChIKey of N,N-dimethyl-2,3,4,5-tetrahydropyridin-6-amine?
The InChIKey is DTTIIBLQHFOAAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-9(2)7-5-3-4-6-8-7/h3-6H2,1-2H3.
What are the key properties of N,N-dimethyl-2,3,4,5-tetrahydropyridin-6-amine?
N,N-dimethyl-2,3,4,5-tetrahydropyridin-6-amine has a molecular weight of 126.20 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2,3,4,5-tetrahydropyridin-6-amine is sourced from PubChem (CID 13447030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).