About N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide
N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 134470461) has the molecular formula C8H8BrClFNO
and a molecular weight of 268.51 g/mol. Its IUPAC name is N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide |
| PubChem CID | 134470461 |
| Molecular Formula | C8H8BrClFNO |
| Molecular Weight | 268.51 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=CC(F)C(Br)C(Cl)=C1 |
| InChI | InChI=1S/C8H8BrClFNO/c1-4(13)12-5-2-6(10)8(9)7(11)3-5/h2-3,7-8H,1H3,(H,12,13) |
| InChIKey | HRDSKLDOGMQAAE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide?
The IUPAC name of N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide (CID 134470461) is N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide.
What is the SMILES notation for N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide?
The canonical SMILES for N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide is CC(=O)NC1=CC(F)C(Br)C(Cl)=C1.
What is the InChIKey of N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide?
The InChIKey is HRDSKLDOGMQAAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrClFNO/c1-4(13)12-5-2-6(10)8(9)7(11)3-5/h2-3,7-8H,1H3,(H,12,13).
What are the key properties of N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide?
N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide has a molecular weight of 268.51 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-5-chloro-3-fluorocyclohexa-1,5-dien-1-yl)acetamide is sourced from PubChem (CID 134470461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).