C16H24O8 — CID 13447077
2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-triene-19,22-diol (PubChem CID 13447077) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is 2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-triene-19,22-diol.
| Compound Name | 2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-triene-19,22-diol |
|---|---|
| PubChem CID | 13447077 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-triene-19,22-diol |
| SMILES | Oc1ccc(O)c2c1OCCOCCOCCOCCOCCO2 |
| InChI | InChI=1S/C16H24O8/c17-13-1-2-14(18)16-15(13)23-11-9-21-7-5-19-3-4-20-6-8-22-10-12-24-16/h1-2,17-18H,3-12H2 |
| InChIKey | MXNOFRYYXAUWCW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|