C24H35N4PS2 — CID 134471111
1-[2-[[(4R,5R)-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidin-2-yl]sulfanyl]ethyl]-3-methylthiourea (PubChem CID 134471111) has the molecular formula C24H35N4PS2 and a molecular weight of 474.68 g/mol. Its IUPAC name is 1-[2-[[(4R,5R)-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidin-2-yl]sulfanyl]ethyl]-3-methylthiourea.
| Compound Name | 1-[2-[[(4R,5R)-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidin-2-yl]sulfanyl]ethyl]-3-methylthiourea |
|---|---|
| PubChem CID | 134471111 |
| Molecular Formula | C24H35N4PS2 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 1-[2-[[(4R,5R)-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidin-2-yl]sulfanyl]ethyl]-3-methylthiourea |
| SMILES | CNC(=S)NCCSP1N(C(C)C)[C@H](c2ccccc2)[C@@H](c2ccccc2)N1C(C)C |
| InChI | InChI=1S/C24H35N4PS2/c1-18(2)27-22(20-12-8-6-9-13-20)23(21-14-10-7-11-15-21)28(19(3)4)29(27)31-17-16-26-24(30)25-5/h6-15,18-19,22-23H,16-17H2,1-5H3,(H2,25,26,30)/t22-,23-/m1/s1 |
| InChIKey | AEUYBSVQAUTERD-DHIUTWEWSA-N |
| XLogP | 5.96 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|