C12H19N4PS2 — CID 134471114
1-[2-[(1,3-dimethyl-1,3,2-benzodiazaphosphol-2-yl)sulfanyl]ethyl]-3-methylthiourea (PubChem CID 134471114) has the molecular formula C12H19N4PS2 and a molecular weight of 314.42 g/mol. Its IUPAC name is 1-[2-[(1,3-dimethyl-1,3,2-benzodiazaphosphol-2-yl)sulfanyl]ethyl]-3-methylthiourea.
| Compound Name | 1-[2-[(1,3-dimethyl-1,3,2-benzodiazaphosphol-2-yl)sulfanyl]ethyl]-3-methylthiourea |
|---|---|
| PubChem CID | 134471114 |
| Molecular Formula | C12H19N4PS2 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-[2-[(1,3-dimethyl-1,3,2-benzodiazaphosphol-2-yl)sulfanyl]ethyl]-3-methylthiourea |
| SMILES | CNC(=S)NCCSP1N(C)c2ccccc2N1C |
| InChI | InChI=1S/C12H19N4PS2/c1-13-12(18)14-8-9-19-17-15(2)10-6-4-5-7-11(10)16(17)3/h4-7H,8-9H2,1-3H3,(H2,13,14,18) |
| InChIKey | ZMCKSDJXXUZCRX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|