C24H26N3OPS — CID 134471124
N-[2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)sulfanyl]ethyl]-N-methylbenzamide (PubChem CID 134471124) has the molecular formula C24H26N3OPS and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)sulfanyl]ethyl]-N-methylbenzamide.
| Compound Name | N-[2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)sulfanyl]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 134471124 |
| Molecular Formula | C24H26N3OPS |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N-[2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)sulfanyl]ethyl]-N-methylbenzamide |
| SMILES | CN(CCSP1N(c2ccccc2)CCN1c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H26N3OPS/c1-25(24(28)21-11-5-2-6-12-21)19-20-30-29-26(22-13-7-3-8-14-22)17-18-27(29)23-15-9-4-10-16-23/h2-16H,17-20H2,1H3 |
| InChIKey | PSTRPUYAKXZLOH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|