C20H25N4O2P — CID 134471311
3-(2-imino-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)-N-methoxy-N-methylbut-3-enamide (PubChem CID 134471311) has the molecular formula C20H25N4O2P and a molecular weight of 384.42 g/mol. Its IUPAC name is 3-(2-imino-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)-N-methoxy-N-methylbut-3-enamide.
| Compound Name | 3-(2-imino-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)-N-methoxy-N-methylbut-3-enamide |
|---|---|
| PubChem CID | 134471311 |
| Molecular Formula | C20H25N4O2P |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 3-(2-imino-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)-N-methoxy-N-methylbut-3-enamide |
| SMILES | [H]N=P1(C(=C)CC(=O)N(C)OC)N(c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C20H25N4O2P/c1-17(16-20(25)22(2)26-3)27(21)23(18-10-6-4-7-11-18)14-15-24(27)19-12-8-5-9-13-19/h4-13,21H,1,14-16H2,2-3H3 |
| InChIKey | YIIXLJGOBQWGJU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 59.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|