C29H43N2O2P — CID 134471318
1-[1,3-bis[2,6-di(propan-2-yl)phenyl]-2-oxo-1,3,2λ5-diazaphospholidin-2-yl]propan-1-one (PubChem CID 134471318) has the molecular formula C29H43N2O2P and a molecular weight of 482.65 g/mol. Its IUPAC name is 1-[1,3-bis[2,6-di(propan-2-yl)phenyl]-2-oxo-1,3,2λ5-diazaphospholidin-2-yl]propan-1-one.
| Compound Name | 1-[1,3-bis[2,6-di(propan-2-yl)phenyl]-2-oxo-1,3,2λ5-diazaphospholidin-2-yl]propan-1-one |
|---|---|
| PubChem CID | 134471318 |
| Molecular Formula | C29H43N2O2P |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | 1-[1,3-bis[2,6-di(propan-2-yl)phenyl]-2-oxo-1,3,2λ5-diazaphospholidin-2-yl]propan-1-one |
| SMILES | CCC(=O)P1(=O)N(c2c(C(C)C)cccc2C(C)C)CCN1c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C29H43N2O2P/c1-10-27(32)34(33)30(28-23(19(2)3)13-11-14-24(28)20(4)5)17-18-31(34)29-25(21(6)7)15-12-16-26(29)22(8)9/h11-16,19-22H,10,17-18H2,1-9H3 |
| InChIKey | NPGFONKETTYLJL-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|