C20H26ClN2P — CID 134471350
(4R,5R)-2-chloro-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidine (PubChem CID 134471350) has the molecular formula C20H26ClN2P and a molecular weight of 360.87 g/mol. Its IUPAC name is (4R,5R)-2-chloro-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidine.
| Compound Name | (4R,5R)-2-chloro-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidine |
|---|---|
| PubChem CID | 134471350 |
| Molecular Formula | C20H26ClN2P |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (4R,5R)-2-chloro-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidine |
| SMILES | CC(C)N1[C@H](c2ccccc2)[C@@H](c2ccccc2)N(C(C)C)P1Cl |
| InChI | InChI=1S/C20H26ClN2P/c1-15(2)22-19(17-11-7-5-8-12-17)20(18-13-9-6-10-14-18)23(16(3)4)24(22)21/h5-16,19-20H,1-4H3/t19-,20-/m1/s1 |
| InChIKey | MEXYLBITTPOCGE-WOJBJXKFSA-N |
| XLogP | 6.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|