C26H37FO3S — CID 134472077
(1S,3Z)-3-[(2E)-2-[(3aS)-1-[(E)-5-fluoro-5-methylsulfonylhex-3-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 134472077) has the molecular formula C26H37FO3S and a molecular weight of 448.64 g/mol. Its IUPAC name is (1S,3Z)-3-[(2E)-2-[(3aS)-1-[(E)-5-fluoro-5-methylsulfonylhex-3-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (1S,3Z)-3-[(2E)-2-[(3aS)-1-[(E)-5-fluoro-5-methylsulfonylhex-3-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 134472077 |
| Molecular Formula | C26H37FO3S |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (1S,3Z)-3-[(2E)-2-[(3aS)-1-[(E)-5-fluoro-5-methylsulfonylhex-3-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC[C@H](O)C/C1=C/C=C1\CCCC2(C)C(C(C)/C=C/C(C)(F)S(C)(=O)=O)=CC[C@@H]12 |
| InChI | InChI=1S/C26H37FO3S/c1-18-8-11-22(28)17-21(18)10-9-20-7-6-15-25(3)23(12-13-24(20)25)19(2)14-16-26(4,27)31(5,29)30/h9-10,12,14,16,19,22,24,28H,1,6-8,11,13,15,17H2,2-5H3/b16-14+,20-9+,21-10-/t19?,22-,24-,25?,26?/m0/s1 |
| InChIKey | KOACYPYFEKJIDU-VBRTYGFCSA-N |
| XLogP | 6.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|