C25H23N3O8S2 — CID 134472663
N-[5,6-bis(hydroxymethyl)-1,3-benzothiazol-2-yl]-2-(4-ethylsulfonylphenyl)-2-(4-nitrophenoxy)acetamide (PubChem CID 134472663) has the molecular formula C25H23N3O8S2 and a molecular weight of 557.61 g/mol. Its IUPAC name is N-[5,6-bis(hydroxymethyl)-1,3-benzothiazol-2-yl]-2-(4-ethylsulfonylphenyl)-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[5,6-bis(hydroxymethyl)-1,3-benzothiazol-2-yl]-2-(4-ethylsulfonylphenyl)-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 134472663 |
| Molecular Formula | C25H23N3O8S2 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.09 |
| IUPAC Name | N-[5,6-bis(hydroxymethyl)-1,3-benzothiazol-2-yl]-2-(4-ethylsulfonylphenyl)-2-(4-nitrophenoxy)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(C(Oc2ccc([N+](=O)[O-])cc2)C(=O)Nc2nc3cc(CO)c(CO)cc3s2)cc1 |
| InChI | InChI=1S/C25H23N3O8S2/c1-2-38(34,35)20-9-3-15(4-10-20)23(36-19-7-5-18(6-8-19)28(32)33)24(31)27-25-26-21-11-16(13-29)17(14-30)12-22(21)37-25/h3-12,23,29-30H,2,13-14H2,1H3,(H,26,27,31) |
| InChIKey | RIEUWHIVWHFCGU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 168.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|