C14H28NO5P — CID 134472737
1-[4-(2-dimethoxyphosphoryl-1-hydroxyethyl)piperidin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 134472737) has the molecular formula C14H28NO5P and a molecular weight of 321.35 g/mol. Its IUPAC name is 1-[4-(2-dimethoxyphosphoryl-1-hydroxyethyl)piperidin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-(2-dimethoxyphosphoryl-1-hydroxyethyl)piperidin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 134472737 |
| Molecular Formula | C14H28NO5P |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-[4-(2-dimethoxyphosphoryl-1-hydroxyethyl)piperidin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | COP(=O)(CC(O)C1CCN(C(=O)C(C)(C)C)CC1)OC |
| InChI | InChI=1S/C14H28NO5P/c1-14(2,3)13(17)15-8-6-11(7-9-15)12(16)10-21(18,19-4)20-5/h11-12,16H,6-10H2,1-5H3 |
| InChIKey | YBYYICZTLCNFTH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|