C38H28N2O2 — CID 134472849
3,10-bis(4-methylphenyl)-6,13-diphenyl-5,12-dioxa-7,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),7,9,11(15)-hexaene (PubChem CID 134472849) has the molecular formula C38H28N2O2 and a molecular weight of 544.65 g/mol. Its IUPAC name is 3,10-bis(4-methylphenyl)-6,13-diphenyl-5,12-dioxa-7,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),7,9,11(15)-hexaene.
| Compound Name | 3,10-bis(4-methylphenyl)-6,13-diphenyl-5,12-dioxa-7,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),7,9,11(15)-hexaene |
|---|---|
| PubChem CID | 134472849 |
| Molecular Formula | C38H28N2O2 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 3,10-bis(4-methylphenyl)-6,13-diphenyl-5,12-dioxa-7,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),7,9,11(15)-hexaene |
| SMILES | Cc1ccc(-c2cc3c4c(c(-c5ccc(C)cc5)cc5c4c2OC(c2ccccc2)N=5)OC(c2ccccc2)N=3)cc1 |
| InChI | InChI=1S/C38H28N2O2/c1-23-13-17-25(18-14-23)29-21-31-34-33-32(40-37(41-35(29)33)27-9-5-3-6-10-27)22-30(26-19-15-24(2)16-20-26)36(34)42-38(39-31)28-11-7-4-8-12-28/h3-22,37-38H,1-2H3 |
| InChIKey | BRBNROMBAVZICA-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |