About (5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine
(5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine (PubChem CID 134472933) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is (5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | (5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine |
| PubChem CID | 134472933 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine |
| SMILES | C/C=C1/CCCN=C1C |
| InChI | InChI=1S/C8H13N/c1-3-8-5-4-6-9-7(8)2/h3H,4-6H2,1-2H3/b8-3- |
| InChIKey | OTPZKEIVFKGPAP-BAQGIRSFSA-N |
| XLogP | 2.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine?
The IUPAC name of (5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine (CID 134472933) is (5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for (5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine?
The canonical SMILES for (5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine is C/C=C1/CCCN=C1C.
What is the InChIKey of (5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine?
The InChIKey is OTPZKEIVFKGPAP-BAQGIRSFSA-N. The full InChI is InChI=1S/C8H13N/c1-3-8-5-4-6-9-7(8)2/h3H,4-6H2,1-2H3/b8-3-.
What are the key properties of (5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine?
(5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine has a molecular weight of 123.20 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-ethylidene-6-methyl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 134472933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).