About N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine
N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine (PubChem CID 134473571) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine.
Molecular Properties
| Compound Name | N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine |
| PubChem CID | 134473571 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine |
| SMILES | C=C/C(NC1CCOCC1)=C(/C)CC |
| InChI | InChI=1S/C12H21NO/c1-4-10(3)12(5-2)13-11-6-8-14-9-7-11/h5,11,13H,2,4,6-9H2,1,3H3/b12-10+ |
| InChIKey | FPQGXIWFSRBACO-ZRDIBKRKSA-N |
| XLogP | 2.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine?
The IUPAC name of N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine (CID 134473571) is N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine.
What is the SMILES notation for N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine?
The canonical SMILES for N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine is C=C/C(NC1CCOCC1)=C(/C)CC.
What is the InChIKey of N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine?
The InChIKey is FPQGXIWFSRBACO-ZRDIBKRKSA-N. The full InChI is InChI=1S/C12H21NO/c1-4-10(3)12(5-2)13-11-6-8-14-9-7-11/h5,11,13H,2,4,6-9H2,1,3H3/b12-10+.
What are the key properties of N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine?
N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine has a molecular weight of 195.31 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-4-methylhexa-1,3-dien-3-yl]oxan-4-amine is sourced from PubChem (CID 134473571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).