About 2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine
2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine (PubChem CID 134473681) has the molecular formula C13H24N2O2S
and a molecular weight of 272.41 g/mol. Its IUPAC name is 2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 134473681 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=CCN(S(=O)(=O)C2CCCN(C)C2)C(C)C1 |
| InChI | InChI=1S/C13H24N2O2S/c1-11-6-8-15(12(2)9-11)18(16,17)13-5-4-7-14(3)10-13/h6,12-13H,4-5,7-10H2,1-3H3 |
| InChIKey | KCTHKRIWRNBCIA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine (CID 134473681) is 2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine is CC1=CCN(S(=O)(=O)C2CCCN(C)C2)C(C)C1.
What is the InChIKey of 2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine?
The InChIKey is KCTHKRIWRNBCIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O2S/c1-11-6-8-15(12(2)9-11)18(16,17)13-5-4-7-14(3)10-13/h6,12-13H,4-5,7-10H2,1-3H3.
What are the key properties of 2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine?
2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine has a molecular weight of 272.41 g/mol, XLogP of 1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1-(1-methylpiperidin-3-yl)sulfonyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 134473681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).