C22H21F5N4O4 — CID 134474422
5-fluoro-N-(5-fluoro-2-methylphenyl)-4-[[(Z)-(4-formylmorpholin-3-ylidene)amino]-methylamino]-2-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 134474422) has the molecular formula C22H21F5N4O4 and a molecular weight of 500.42 g/mol. Its IUPAC name is 5-fluoro-N-(5-fluoro-2-methylphenyl)-4-[[(Z)-(4-formylmorpholin-3-ylidene)amino]-methylamino]-2-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | 5-fluoro-N-(5-fluoro-2-methylphenyl)-4-[[(Z)-(4-formylmorpholin-3-ylidene)amino]-methylamino]-2-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 134474422 |
| Molecular Formula | C22H21F5N4O4 |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 5-fluoro-N-(5-fluoro-2-methylphenyl)-4-[[(Z)-(4-formylmorpholin-3-ylidene)amino]-methylamino]-2-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | Cc1ccc(F)cc1NC(=O)c1cc(F)c(N(C)/N=C2/COCCN2C=O)cc1OCC(F)(F)F |
| InChI | InChI=1S/C22H21F5N4O4/c1-13-3-4-14(23)7-17(13)28-21(33)15-8-16(24)18(9-19(15)35-11-22(25,26)27)30(2)29-20-10-34-6-5-31(20)12-32/h3-4,7-9,12H,5-6,10-11H2,1-2H3,(H,28,33)/b29-20- |
| InChIKey | DKSQWTZHHNNZMT-BRPDVVIDSA-N |
| XLogP | 3.70 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|