About (Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine
(Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine (PubChem CID 134474636) has the molecular formula C16H27N3
and a molecular weight of 261.41 g/mol. Its IUPAC name is (Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine |
| PubChem CID | 134474636 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | (Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine |
| SMILES | CN/C=C\NCCc1ccccc1CCCCNC |
| InChI | InChI=1S/C16H27N3/c1-17-11-6-5-9-15-7-3-4-8-16(15)10-12-19-14-13-18-2/h3-4,7-8,13-14,17-19H,5-6,9-12H2,1-2H3/b14-13- |
| InChIKey | YKCNVWDZEMXFDM-YPKPFQOOSA-N |
| XLogP | 2.05 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine?
The IUPAC name of (Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine (CID 134474636) is (Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine.
What is the SMILES notation for (Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine?
The canonical SMILES for (Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine is CN/C=C\NCCc1ccccc1CCCCNC.
What is the InChIKey of (Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine?
The InChIKey is YKCNVWDZEMXFDM-YPKPFQOOSA-N. The full InChI is InChI=1S/C16H27N3/c1-17-11-6-5-9-15-7-3-4-8-16(15)10-12-19-14-13-18-2/h3-4,7-8,13-14,17-19H,5-6,9-12H2,1-2H3/b14-13-.
What are the key properties of (Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine?
(Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine has a molecular weight of 261.41 g/mol, XLogP of 2.05, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-methyl-N'-[2-[2-[4-(methylamino)butyl]phenyl]ethyl]ethene-1,2-diamine is sourced from PubChem (CID 134474636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).