C13H21O3P — CID 134475153
(1S,8R)-5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one (PubChem CID 134475153) has the molecular formula C13H21O3P and a molecular weight of 256.28 g/mol. Its IUPAC name is (1S,8R)-5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one.
| Compound Name | (1S,8R)-5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one |
|---|---|
| PubChem CID | 134475153 |
| Molecular Formula | C13H21O3P |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (1S,8R)-5-ethyl-7-hydroxy-1-methyl-8-phosphanyl-11-oxatricyclo[6.2.1.02,6]undecan-10-one |
| SMILES | CCC1CCC2C1C(O)[C@]1(P)CC(=O)[C@@]2(C)O1 |
| InChI | InChI=1S/C13H21O3P/c1-3-7-4-5-8-10(7)11(15)13(17)6-9(14)12(8,2)16-13/h7-8,10-11,15H,3-6,17H2,1-2H3/t7?,8?,10?,11?,12-,13+/m0/s1 |
| InChIKey | ZFCNZADOLNEAMU-XAWURGNVSA-N |
| XLogP | 1.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|