C25H23ClF3N3O4 — CID 134475176
4-[[[2-chloro-5-(3-hydroxy-3-methylbut-1-ynyl)-3-[[4-(trifluoromethyl)phenyl]methyl]-1,2-dihydroimidazole-4-carbonyl]amino]methyl]benzoic acid (PubChem CID 134475176) has the molecular formula C25H23ClF3N3O4 and a molecular weight of 521.92 g/mol. Its IUPAC name is 4-[[[2-chloro-5-(3-hydroxy-3-methylbut-1-ynyl)-3-[[4-(trifluoromethyl)phenyl]methyl]-1,2-dihydroimidazole-4-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-chloro-5-(3-hydroxy-3-methylbut-1-ynyl)-3-[[4-(trifluoromethyl)phenyl]methyl]-1,2-dihydroimidazole-4-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 134475176 |
| Molecular Formula | C25H23ClF3N3O4 |
| Molecular Weight | 521.92 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 4-[[[2-chloro-5-(3-hydroxy-3-methylbut-1-ynyl)-3-[[4-(trifluoromethyl)phenyl]methyl]-1,2-dihydroimidazole-4-carbonyl]amino]methyl]benzoic acid |
| SMILES | CC(C)(O)C#CC1=C(C(=O)NCc2ccc(C(=O)O)cc2)N(Cc2ccc(C(F)(F)F)cc2)C(Cl)N1 |
| InChI | InChI=1S/C25H23ClF3N3O4/c1-24(2,36)12-11-19-20(21(33)30-13-15-3-7-17(8-4-15)22(34)35)32(23(26)31-19)14-16-5-9-18(10-6-16)25(27,28)29/h3-10,23,31,36H,13-14H2,1-2H3,(H,30,33)(H,34,35) |
| InChIKey | CVOPCPJABFYNKE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.92 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|