C25H25ClFN3O4 — CID 134475405
4-[[[2-chloro-3-[(4-fluorophenyl)methyl]-5-(3-methoxy-3-methylbut-1-ynyl)-1,2-dihydroimidazole-4-carbonyl]amino]methyl]benzoic acid (PubChem CID 134475405) has the molecular formula C25H25ClFN3O4 and a molecular weight of 485.94 g/mol. Its IUPAC name is 4-[[[2-chloro-3-[(4-fluorophenyl)methyl]-5-(3-methoxy-3-methylbut-1-ynyl)-1,2-dihydroimidazole-4-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-chloro-3-[(4-fluorophenyl)methyl]-5-(3-methoxy-3-methylbut-1-ynyl)-1,2-dihydroimidazole-4-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 134475405 |
| Molecular Formula | C25H25ClFN3O4 |
| Molecular Weight | 485.94 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 4-[[[2-chloro-3-[(4-fluorophenyl)methyl]-5-(3-methoxy-3-methylbut-1-ynyl)-1,2-dihydroimidazole-4-carbonyl]amino]methyl]benzoic acid |
| SMILES | COC(C)(C)C#CC1=C(C(=O)NCc2ccc(C(=O)O)cc2)N(Cc2ccc(F)cc2)C(Cl)N1 |
| InChI | InChI=1S/C25H25ClFN3O4/c1-25(2,34-3)13-12-20-21(22(31)28-14-16-4-8-18(9-5-16)23(32)33)30(24(26)29-20)15-17-6-10-19(27)11-7-17/h4-11,24,29H,14-15H2,1-3H3,(H,28,31)(H,32,33) |
| InChIKey | FVDQMOGXEUOVFX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.94 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|