C24H29ClF3N3O2 — CID 134475493
2-chloro-N-(cyclohexylmethyl)-5-(3-hydroxy-3-methylbut-1-ynyl)-3-[[3-(trifluoromethyl)phenyl]methyl]-1,2-dihydroimidazole-4-carboxamide (PubChem CID 134475493) has the molecular formula C24H29ClF3N3O2 and a molecular weight of 483.96 g/mol. Its IUPAC name is 2-chloro-N-(cyclohexylmethyl)-5-(3-hydroxy-3-methylbut-1-ynyl)-3-[[3-(trifluoromethyl)phenyl]methyl]-1,2-dihydroimidazole-4-carboxamide.
| Compound Name | 2-chloro-N-(cyclohexylmethyl)-5-(3-hydroxy-3-methylbut-1-ynyl)-3-[[3-(trifluoromethyl)phenyl]methyl]-1,2-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 134475493 |
| Molecular Formula | C24H29ClF3N3O2 |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 2-chloro-N-(cyclohexylmethyl)-5-(3-hydroxy-3-methylbut-1-ynyl)-3-[[3-(trifluoromethyl)phenyl]methyl]-1,2-dihydroimidazole-4-carboxamide |
| SMILES | CC(C)(O)C#CC1=C(C(=O)NCC2CCCCC2)N(Cc2cccc(C(F)(F)F)c2)C(Cl)N1 |
| InChI | InChI=1S/C24H29ClF3N3O2/c1-23(2,33)12-11-19-20(21(32)29-14-16-7-4-3-5-8-16)31(22(25)30-19)15-17-9-6-10-18(13-17)24(26,27)28/h6,9-10,13,16,22,30,33H,3-5,7-8,14-15H2,1-2H3,(H,29,32) |
| InChIKey | HJWIYUVMYHLJMT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|