About 4-(2,2-dimethylheptyl)-1,3-dioxol-2-one
4-(2,2-dimethylheptyl)-1,3-dioxol-2-one (PubChem CID 134475917) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 4-(2,2-dimethylheptyl)-1,3-dioxol-2-one.
Molecular Properties
| Compound Name | 4-(2,2-dimethylheptyl)-1,3-dioxol-2-one |
| PubChem CID | 134475917 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 4-(2,2-dimethylheptyl)-1,3-dioxol-2-one |
| SMILES | CCCCCC(C)(C)Cc1coc(=O)o1 |
| InChI | InChI=1S/C12H20O3/c1-4-5-6-7-12(2,3)8-10-9-14-11(13)15-10/h9H,4-8H2,1-3H3 |
| InChIKey | OLTOWIDVKCIHFD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-dimethylheptyl)-1,3-dioxol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethylheptyl)-1,3-dioxol-2-one?
The IUPAC name of 4-(2,2-dimethylheptyl)-1,3-dioxol-2-one (CID 134475917) is 4-(2,2-dimethylheptyl)-1,3-dioxol-2-one.
What is the SMILES notation for 4-(2,2-dimethylheptyl)-1,3-dioxol-2-one?
The canonical SMILES for 4-(2,2-dimethylheptyl)-1,3-dioxol-2-one is CCCCCC(C)(C)Cc1coc(=O)o1.
What is the InChIKey of 4-(2,2-dimethylheptyl)-1,3-dioxol-2-one?
The InChIKey is OLTOWIDVKCIHFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-4-5-6-7-12(2,3)8-10-9-14-11(13)15-10/h9H,4-8H2,1-3H3.
What are the key properties of 4-(2,2-dimethylheptyl)-1,3-dioxol-2-one?
4-(2,2-dimethylheptyl)-1,3-dioxol-2-one has a molecular weight of 212.29 g/mol, XLogP of 3.38, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylheptyl)-1,3-dioxol-2-one is sourced from PubChem (CID 134475917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).